C9H15N — CID 123351089
3-ethyl-N-methylcyclohexa-2,4-dien-1-amine (PubChem CID 123351089) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 3-ethyl-N-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | 3-ethyl-N-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123351089 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 3-ethyl-N-methylcyclohexa-2,4-dien-1-amine |
| SMILES | CCC1=CC(NC)CC=C1 |
| InChI | InChI=1S/C9H15N/c1-3-8-5-4-6-9(7-8)10-2/h4-5,7,9-10H,3,6H2,1-2H3 |
| InChIKey | PFYXBBOTMDCCPW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |