C9H15NO — CID 163983354
N-(3-propylcyclohexa-1,5-dien-1-yl)hydroxylamine (PubChem CID 163983354) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is N-(3-propylcyclohexa-1,5-dien-1-yl)hydroxylamine.
| Compound Name | N-(3-propylcyclohexa-1,5-dien-1-yl)hydroxylamine |
|---|---|
| PubChem CID | 163983354 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-(3-propylcyclohexa-1,5-dien-1-yl)hydroxylamine |
| SMILES | CCCC1C=C(NO)C=CC1 |
| InChI | InChI=1S/C9H15NO/c1-2-4-8-5-3-6-9(7-8)10-11/h3,6-8,10-11H,2,4-5H2,1H3 |
| InChIKey | TUEIYUXUSUQSTC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|