C10H17N — CID 141432673
5-prop-1-en-2-yl-3-propyl-2,3-dihydro-1H-pyrrole (PubChem CID 141432673) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 5-prop-1-en-2-yl-3-propyl-2,3-dihydro-1H-pyrrole.
| Compound Name | 5-prop-1-en-2-yl-3-propyl-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 141432673 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 5-prop-1-en-2-yl-3-propyl-2,3-dihydro-1H-pyrrole |
| SMILES | C=C(C)C1=CC(CCC)CN1 |
| InChI | InChI=1S/C10H17N/c1-4-5-9-6-10(8(2)3)11-7-9/h6,9,11H,2,4-5,7H2,1,3H3 |
| InChIKey | GHYGRPQHTPOXQF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |