C15H26 — CID 143640456
ethane;2,3,4,8-tetrahydro-1H-benzo[7]annulene (PubChem CID 143640456) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is ethane;2,3,4,8-tetrahydro-1H-benzo[7]annulene.
| Compound Name | ethane;2,3,4,8-tetrahydro-1H-benzo[7]annulene |
|---|---|
| PubChem CID | 143640456 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | ethane;2,3,4,8-tetrahydro-1H-benzo[7]annulene |
| SMILES | C1=CCC=C2CCCCC2=C1.CC.CC |
| InChI | InChI=1S/C11H14.2C2H6/c1-2-6-10-8-4-5-9-11(10)7-3-1;2*1-2/h1-2,6-7H,3-5,8-9H2;2*1-2H3 |
| InChIKey | KXXCQSCGSCSKSG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |