C13H16 — CID 173241187
2-(cyclohexen-1-yl)cyclohepta-1,3,5-triene (PubChem CID 173241187) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)cyclohepta-1,3,5-triene.
| Compound Name | 2-(cyclohexen-1-yl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 173241187 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-(cyclohexen-1-yl)cyclohepta-1,3,5-triene |
| SMILES | C1=CCC=C(C2=CCCCC2)C=C1 |
| InChI | InChI=1S/C13H16/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-13/h1-2,4,8-10H,3,5-7,11H2 |
| InChIKey | DTUYITPAVHACMZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |