C10H10 — CID 21189020
2,4-dihydroazulene (PubChem CID 21189020) has the molecular formula C10H10 and a molecular weight of 130.19 g/mol. Its IUPAC name is 2,4-dihydroazulene.
| Compound Name | 2,4-dihydroazulene |
|---|---|
| PubChem CID | 21189020 |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 2,4-dihydroazulene |
| SMILES | C1=CCC2=CCC=C2C=C1 |
| InChI | InChI=1S/C10H10/c1-2-5-9-7-4-8-10(9)6-3-1/h1-3,5,7-8H,4,6H2 |
| InChIKey | SYOUKWIOKDRPRO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |