C19H34 — CID 154646973
ethane;methane;2-phenylcyclohepta-1,3,5-triene (PubChem CID 154646973) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is ethane;methane;2-phenylcyclohepta-1,3,5-triene.
| Compound Name | ethane;methane;2-phenylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 154646973 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | ethane;methane;2-phenylcyclohepta-1,3,5-triene |
| SMILES | C.C.C.C.C1=CCC=C(c2ccccc2)C=C1.CC |
| InChI | InChI=1S/C13H12.C2H6.4CH4/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-13;1-2;;;;/h1-4,6-11H,5H2;1-2H3;4*1H4 |
| InChIKey | LCDMEBGMVFQRKO-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |