C16H20O — CID 143019202
cyclohepta-1,4,6-trien-1-yl(phenyl)methanol;ethane (PubChem CID 143019202) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is cyclohepta-1,4,6-trien-1-yl(phenyl)methanol;ethane.
| Compound Name | cyclohepta-1,4,6-trien-1-yl(phenyl)methanol;ethane |
|---|---|
| PubChem CID | 143019202 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | cyclohepta-1,4,6-trien-1-yl(phenyl)methanol;ethane |
| SMILES | CC.OC(C1=CCC=CC=C1)c1ccccc1 |
| InChI | InChI=1S/C14H14O.C2H6/c15-14(13-10-6-3-7-11-13)12-8-4-1-2-5-9-12;1-2/h1-4,6-11,14-15H,5H2;1-2H3 |
| InChIKey | ITFMDCLKMOKAEW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |