C15H20N2O — CID 154107415
[4,4-bis(methylamino)cyclohexa-1,5-dien-1-yl]-phenylmethanol (PubChem CID 154107415) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is [4,4-bis(methylamino)cyclohexa-1,5-dien-1-yl]-phenylmethanol.
| Compound Name | [4,4-bis(methylamino)cyclohexa-1,5-dien-1-yl]-phenylmethanol |
|---|---|
| PubChem CID | 154107415 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | [4,4-bis(methylamino)cyclohexa-1,5-dien-1-yl]-phenylmethanol |
| SMILES | CNC1(NC)C=CC(C(O)c2ccccc2)=CC1 |
| InChI | InChI=1S/C15H20N2O/c1-16-15(17-2)10-8-13(9-11-15)14(18)12-6-4-3-5-7-12/h3-10,14,16-18H,11H2,1-2H3 |
| InChIKey | LCGGUDMPOSOEAE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|