C12H15NO — CID 129203731
cyclodecapentaenyl(methylamino)methanol (PubChem CID 129203731) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is cyclodecapentaenyl(methylamino)methanol.
| Compound Name | cyclodecapentaenyl(methylamino)methanol |
|---|---|
| PubChem CID | 129203731 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | cyclodecapentaenyl(methylamino)methanol |
| SMILES | CNC(O)c1ccccccccc1 |
| InChI | InChI=1S/C12H15NO/c1-13-12(14)11-9-7-5-3-2-4-6-8-10-11/h2-10,12-14H,1H3/b3-2-,4-2-,5-3-,6-4+,7-5+,8-6+,9-7+,10-8-,11-9+,11-10+ |
| InChIKey | WZNFAPQNVUUCLN-WHPVTRNFSA-N |
| XLogP | 2.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|