C23H31NO3 — CID 143127807
4-[cyclohepta-1,4,6-trien-1-yl(phenyl)methoxy]-1-methylpiperidine;ethyl formate (PubChem CID 143127807) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-[cyclohepta-1,4,6-trien-1-yl(phenyl)methoxy]-1-methylpiperidine;ethyl formate.
| Compound Name | 4-[cyclohepta-1,4,6-trien-1-yl(phenyl)methoxy]-1-methylpiperidine;ethyl formate |
|---|---|
| PubChem CID | 143127807 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 4-[cyclohepta-1,4,6-trien-1-yl(phenyl)methoxy]-1-methylpiperidine;ethyl formate |
| SMILES | CCOC=O.CN1CCC(OC(C2=CCC=CC=C2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H25NO.C3H6O2/c1-21-15-13-19(14-16-21)22-20(18-11-7-4-8-12-18)17-9-5-2-3-6-10-17;1-2-5-3-4/h2-5,7-12,19-20H,6,13-16H2,1H3;3H,2H2,1H3 |
| InChIKey | ZCRNEGWCPZGMPU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|