C15H14O — CID 143363628
1-(4-cyclohepta-1,4,6-trien-1-ylphenyl)ethanone (PubChem CID 143363628) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-(4-cyclohepta-1,4,6-trien-1-ylphenyl)ethanone.
| Compound Name | 1-(4-cyclohepta-1,4,6-trien-1-ylphenyl)ethanone |
|---|---|
| PubChem CID | 143363628 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-(4-cyclohepta-1,4,6-trien-1-ylphenyl)ethanone |
| SMILES | CC(=O)c1ccc(C2=CCC=CC=C2)cc1 |
| InChI | InChI=1S/C15H14O/c1-12(16)13-8-10-15(11-9-13)14-6-4-2-3-5-7-14/h2-4,6-11H,5H2,1H3 |
| InChIKey | GDBNZSBZROMQHW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |