C11H10 — CID 136672977
(4Z,6Z)-8H-cyclopenta[8]annulene (PubChem CID 136672977) has the molecular formula C11H10 and a molecular weight of 142.20 g/mol. Its IUPAC name is (4Z,6Z)-8H-cyclopenta[8]annulene.
| Compound Name | (4Z,6Z)-8H-cyclopenta[8]annulene |
|---|---|
| PubChem CID | 136672977 |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | (4Z,6Z)-8H-cyclopenta[8]annulene |
| SMILES | C1=CC2=CC/C=C\C=C/C2=C1 |
| InChI | InChI=1S/C11H10/c1-2-4-7-11-9-5-8-10(11)6-3-1/h1-3,5-9H,4H2/b2-1-,6-3-,11-7? |
| InChIKey | FEVQUPDHLAWTFO-FXEMYDTNSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |