C16H14 — CID 54413648
bicyclo[7.7.0]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 54413648) has the molecular formula C16H14 and a molecular weight of 206.29 g/mol. Its IUPAC name is bicyclo[7.7.0]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | bicyclo[7.7.0]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 54413648 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | bicyclo[7.7.0]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C1=CC=CC2=CC=CC=CC=CC2=CC=C1 |
| InChI | InChI=1S/C16H14/c1-3-7-11-15-13-9-5-2-6-10-14-16(15)12-8-4-1/h1-14H |
| InChIKey | VVWHUSKZLPCMIO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |