C14H16 — CID 172998044
2-cyclohepta-1,4-dien-1-ylcyclohepta-1,3,5-triene (PubChem CID 172998044) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-cyclohepta-1,4-dien-1-ylcyclohepta-1,3,5-triene.
| Compound Name | 2-cyclohepta-1,4-dien-1-ylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 172998044 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 2-cyclohepta-1,4-dien-1-ylcyclohepta-1,3,5-triene |
| SMILES | C1=CCC=C(C2=CCC=CCC2)C=C1 |
| InChI | InChI=1S/C14H16/c1-2-6-10-13(9-5-1)14-11-7-3-4-8-12-14/h1-5,9-11H,6-8,12H2 |
| InChIKey | UFDJSILOCGZWRY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|