About 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+)
1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+) (PubChem CID 21161619) has the molecular formula C10H10Ni+2
and a molecular weight of 188.88 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+).
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+) |
| PubChem CID | 21161619 |
| Molecular Formula | C10H10Ni+2 |
| Molecular Weight | 188.88 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+) |
| SMILES | C1=CCC(C2=CC=CC2)=C1.[Ni+2] |
| InChI | InChI=1S/C10H10.Ni/c1-2-6-9(5-1)10-7-3-4-8-10;/h1-5,7H,6,8H2;/q;+2 |
| InChIKey | GNYDOXHZWKJWII-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.88 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+)?
The IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+) (CID 21161619) is 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+).
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+)?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+) is C1=CCC(C2=CC=CC2)=C1.[Ni+2].
What is the InChIKey of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+)?
The InChIKey is GNYDOXHZWKJWII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.Ni/c1-2-6-9(5-1)10-7-3-4-8-10;/h1-5,7H,6,8H2;/q;+2.
What are the key properties of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+)?
1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+) has a molecular weight of 188.88 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;nickel(2+) is sourced from PubChem (CID 21161619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).