C46H48 — CID 159591609
bis(cyclohexa-1,4-diene);1,5-dihydroanthracene;1,5-dihydronaphthalene;1,7-dihydronaphthalene (PubChem CID 159591609) has the molecular formula C46H48 and a molecular weight of 600.89 g/mol. Its IUPAC name is bis(cyclohexa-1,4-diene);1,5-dihydroanthracene;1,5-dihydronaphthalene;1,7-dihydronaphthalene.
| Compound Name | bis(cyclohexa-1,4-diene);1,5-dihydroanthracene;1,5-dihydronaphthalene;1,7-dihydronaphthalene |
|---|---|
| PubChem CID | 159591609 |
| Molecular Formula | C46H48 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | bis(cyclohexa-1,4-diene);1,5-dihydroanthracene;1,5-dihydronaphthalene;1,7-dihydronaphthalene |
| SMILES | C1=CCC2=CC=CCC2=C1.C1=CCC2=CCC=CC2=C1.C1=CCC=CC1.C1=CCC=CC1.C1=CCc2cc3c(cc2=C1)CC=CC=3 |
| InChI | InChI=1S/C14H12.2C10H10.2C6H8/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;2*1-2-6-10-8-4-3-7-9(10)5-1;2*1-2-4-6-5-3-1/h1-5,8-10H,6-7H2;1-3,5,7-8H,4,6H2;1-5,8H,6-7H2;2*1-2,5-6H,3-4H2 |
| InChIKey | MKHUYOBBTSYTHR-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|