C21H18 — CID 59236022
(2Z,4Z,6Z,8Z,11Z)-tetracyclo[11.7.1.07,21.014,20]henicosa-1(21),2,4,6,8,11,14(20),16,18-nonaene (PubChem CID 59236022) has the molecular formula C21H18 and a molecular weight of 270.38 g/mol. Its IUPAC name is (2Z,4Z,6Z,8Z,11Z)-tetracyclo[11.7.1.07,21.014,20]henicosa-1(21),2,4,6,8,11,14(20),16,18-nonaene.
| Compound Name | (2Z,4Z,6Z,8Z,11Z)-tetracyclo[11.7.1.07,21.014,20]henicosa-1(21),2,4,6,8,11,14(20),16,18-nonaene |
|---|---|
| PubChem CID | 59236022 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (2Z,4Z,6Z,8Z,11Z)-tetracyclo[11.7.1.07,21.014,20]henicosa-1(21),2,4,6,8,11,14(20),16,18-nonaene |
| SMILES | C1=CCC2=C(C=C1)C1=C3C(=C\C=C/C=C\1)/C=C\C/C=C\C23 |
| InChI | InChI=1S/C21H18/c1-4-10-16-11-5-2-9-15-20-18-13-7-3-6-12-17(18)19(14-8-1)21(16)20/h1,3-12,14-15,20H,2,13H2/b4-1-,8-1-,10-4-,11-5-,14-8-,15-9-,16-10-,19-14-,21-16- |
| InChIKey | NWIZUAWKAOXAFF-APDJMEAVSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|