C9H13N — CID 13380462
1,3,5-Cycloheptatrien-1-amine,N,N-dimethyl-,(1Z,3Z,5Z)-(9CI) (PubChem CID 13380462) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is N,N-dimethylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | 1,3,5-Cycloheptatrien-1-amine,N,N-dimethyl-,(1Z,3Z,5Z)-(9CI) |
|---|---|
| PubChem CID | 13380462 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N,N-dimethylcyclohepta-1,3,5-trien-1-amine |
| SMILES | CN(C)C1=CC=CC=CC1 |
| InChI | InChI=1S/C9H13N/c1-10(2)9-7-5-3-4-6-8-9/h3-7H,8H2,1-2H3 |
| InChIKey | NUISSZCPXFHOSR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 185 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |