C7H11N — CID 12679267
N,N-dimethylcyclopenta-1,3-dien-1-amine (PubChem CID 12679267) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is N,N-dimethylcyclopenta-1,3-dien-1-amine.
| Compound Name | N,N-dimethylcyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 12679267 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | N,N-dimethylcyclopenta-1,3-dien-1-amine |
| SMILES | CN(C)C1=CC=CC1 |
| InChI | InChI=1S/C7H11N/c1-8(2)7-5-3-4-6-7/h3-5H,6H2,1-2H3 |
| InChIKey | DGRZHZSNXXATQL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |