About N-fluoro-N-methylcyclopenta-1,3-dien-1-amine
N-fluoro-N-methylcyclopenta-1,3-dien-1-amine (PubChem CID 167054534) has the molecular formula C6H8FN
and a molecular weight of 113.13 g/mol. Its IUPAC name is N-fluoro-N-methylcyclopenta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-fluoro-N-methylcyclopenta-1,3-dien-1-amine |
| PubChem CID | 167054534 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | N-fluoro-N-methylcyclopenta-1,3-dien-1-amine |
| SMILES | CN(F)C1=CC=CC1 |
| InChI | InChI=1S/C6H8FN/c1-8(7)6-4-2-3-5-6/h2-4H,5H2,1H3 |
| InChIKey | WFIHOLAFPFXGBP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-fluoro-N-methylcyclopenta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluoro-N-methylcyclopenta-1,3-dien-1-amine?
The IUPAC name of N-fluoro-N-methylcyclopenta-1,3-dien-1-amine (CID 167054534) is N-fluoro-N-methylcyclopenta-1,3-dien-1-amine.
What is the SMILES notation for N-fluoro-N-methylcyclopenta-1,3-dien-1-amine?
The canonical SMILES for N-fluoro-N-methylcyclopenta-1,3-dien-1-amine is CN(F)C1=CC=CC1.
What is the InChIKey of N-fluoro-N-methylcyclopenta-1,3-dien-1-amine?
The InChIKey is WFIHOLAFPFXGBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FN/c1-8(7)6-4-2-3-5-6/h2-4H,5H2,1H3.
What are the key properties of N-fluoro-N-methylcyclopenta-1,3-dien-1-amine?
N-fluoro-N-methylcyclopenta-1,3-dien-1-amine has a molecular weight of 113.13 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluoro-N-methylcyclopenta-1,3-dien-1-amine is sourced from PubChem (CID 167054534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).