C6H8FN — CID 167054534
N-fluoro-N-methylcyclopenta-1,3-dien-1-amine (PubChem CID 167054534) has the molecular formula C6H8FN and a molecular weight of 113.13 g/mol. Its IUPAC name is N-fluoro-N-methylcyclopenta-1,3-dien-1-amine.
| Compound Name | N-fluoro-N-methylcyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 167054534 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | N-fluoro-N-methylcyclopenta-1,3-dien-1-amine |
| SMILES | CN(F)C1=CC=CC1 |
| InChI | InChI=1S/C6H8FN/c1-8(7)6-4-2-3-5-6/h2-4H,5H2,1H3 |
| InChIKey | WFIHOLAFPFXGBP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|