About 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine
6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine (PubChem CID 167226768) has the molecular formula C9H12FN
and a molecular weight of 153.20 g/mol. Its IUPAC name is 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine.
Molecular Properties
| Compound Name | 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine |
| PubChem CID | 167226768 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine |
| SMILES | C=C(C)N1C=C(F)C=CCC1 |
| InChI | InChI=1S/C9H12FN/c1-8(2)11-6-4-3-5-9(10)7-11/h3,5,7H,1,4,6H2,2H3 |
| InChIKey | HUEMYOMJJCYVMK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine?
The IUPAC name of 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine (CID 167226768) is 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine.
What is the SMILES notation for 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine?
The canonical SMILES for 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine is C=C(C)N1C=C(F)C=CCC1.
What is the InChIKey of 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine?
The InChIKey is HUEMYOMJJCYVMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN/c1-8(2)11-6-4-3-5-9(10)7-11/h3,5,7H,1,4,6H2,2H3.
What are the key properties of 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine?
6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine has a molecular weight of 153.20 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-prop-1-en-2-yl-2,3-dihydroazepine is sourced from PubChem (CID 167226768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).