About 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol
1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol (PubChem CID 174485251) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol |
| PubChem CID | 174485251 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol |
| SMILES | C1=CCC(C2=CC=CC2)=C1.OC(O)O |
| InChI | InChI=1S/C10H10.CH4O3/c1-2-6-9(5-1)10-7-3-4-8-10;2-1(3)4/h1-5,7H,6,8H2;1-4H |
| InChIKey | UKRXPFBBCKFXLB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol?
The IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol (CID 174485251) is 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol is C1=CCC(C2=CC=CC2)=C1.OC(O)O.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol?
The InChIKey is UKRXPFBBCKFXLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.CH4O3/c1-2-6-9(5-1)10-7-3-4-8-10;2-1(3)4/h1-5,7H,6,8H2;1-4H.
What are the key properties of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol?
1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol has a molecular weight of 194.23 g/mol, XLogP of 1.01, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol is sourced from PubChem (CID 174485251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).