C11H14O3 — CID 174485251
1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol (PubChem CID 174485251) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol.
| Compound Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol |
|---|---|
| PubChem CID | 174485251 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methanetriol |
| SMILES | C1=CCC(C2=CC=CC2)=C1.OC(O)O |
| InChI | InChI=1S/C10H10.CH4O3/c1-2-6-9(5-1)10-7-3-4-8-10;2-1(3)4/h1-5,7H,6,8H2;1-4H |
| InChIKey | UKRXPFBBCKFXLB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|