About 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene
1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene (PubChem CID 174827544) has the molecular formula C22H18S
and a molecular weight of 314.45 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene |
| PubChem CID | 174827544 |
| Molecular Formula | C22H18S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene |
| SMILES | C1=CCC(C2=CC=CC2)=C1.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H8S.C10H10/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-6-9(5-1)10-7-3-4-8-10/h1-8H;1-5,7H,6,8H2 |
| InChIKey | CAIDUSSHELHTKY-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene?
The IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene (CID 174827544) is 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene is C1=CCC(C2=CC=CC2)=C1.c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene?
The InChIKey is CAIDUSSHELHTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S.C10H10/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-6-9(5-1)10-7-3-4-8-10/h1-8H;1-5,7H,6,8H2.
What are the key properties of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene?
1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene has a molecular weight of 314.45 g/mol, XLogP of 6.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;dibenzothiophene is sourced from PubChem (CID 174827544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).