About 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene
1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene (PubChem CID 139838075) has the molecular formula C17H16
and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene |
| PubChem CID | 139838075 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene |
| SMILES | Cc1cc(C)c2ccccc2c1C1=CC=CC1 |
| InChI | InChI=1S/C17H16/c1-12-11-13(2)17(14-7-3-4-8-14)16-10-6-5-9-15(12)16/h3-7,9-11H,8H2,1-2H3 |
| InChIKey | SGBAIEDLAQNBOL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene?
The IUPAC name of 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene (CID 139838075) is 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene is Cc1cc(C)c2ccccc2c1C1=CC=CC1.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene?
The InChIKey is SGBAIEDLAQNBOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16/c1-12-11-13(2)17(14-7-3-4-8-14)16-10-6-5-9-15(12)16/h3-7,9-11H,8H2,1-2H3.
What are the key properties of 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene?
1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene has a molecular weight of 220.31 g/mol, XLogP of 4.80, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-yl-2,4-dimethylnaphthalene is sourced from PubChem (CID 139838075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).