C19H20 — CID 144640126
1-cyclopenta-1,3-dien-1-yl-4-methylbenzene;toluene (PubChem CID 144640126) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-4-methylbenzene;toluene.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-4-methylbenzene;toluene |
|---|---|
| PubChem CID | 144640126 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-4-methylbenzene;toluene |
| SMILES | Cc1ccc(C2=CC=CC2)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C12H12.C7H8/c1-10-6-8-12(9-7-10)11-4-2-3-5-11;1-7-5-3-2-4-6-7/h2-4,6-9H,5H2,1H3;2-6H,1H3 |
| InChIKey | SMTAROLECZJNDJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |