C13H10 — CID 101449090
1-cyclopenta-1,3-dien-1-yl-4-ethynylbenzene (PubChem CID 101449090) has the molecular formula C13H10 and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-4-ethynylbenzene.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-4-ethynylbenzene |
|---|---|
| PubChem CID | 101449090 |
| Molecular Formula | C13H10 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-4-ethynylbenzene |
| SMILES | C#Cc1ccc(C2=CC=CC2)cc1 |
| InChI | InChI=1S/C13H10/c1-2-11-7-9-13(10-8-11)12-5-3-4-6-12/h1,3-5,7-10H,6H2 |
| InChIKey | IMLFTXLQBYUDFP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|