About 1-ethynyl-4-methylbenzene;formaldehyde;methane
1-ethynyl-4-methylbenzene;formaldehyde;methane (PubChem CID 143289915) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 1-ethynyl-4-methylbenzene;formaldehyde;methane.
Molecular Properties
| Compound Name | 1-ethynyl-4-methylbenzene;formaldehyde;methane |
| PubChem CID | 143289915 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1-ethynyl-4-methylbenzene;formaldehyde;methane |
| SMILES | C.C#Cc1ccc(C)cc1.C=O |
| InChI | InChI=1S/C9H8.CH2O.CH4/c1-3-9-6-4-8(2)5-7-9;1-2;/h1,4-7H,2H3;1H2;1H4 |
| InChIKey | QYKGDJSRQNRAEX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-4-methylbenzene;formaldehyde;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-4-methylbenzene;formaldehyde;methane?
The IUPAC name of 1-ethynyl-4-methylbenzene;formaldehyde;methane (CID 143289915) is 1-ethynyl-4-methylbenzene;formaldehyde;methane.
What is the SMILES notation for 1-ethynyl-4-methylbenzene;formaldehyde;methane?
The canonical SMILES for 1-ethynyl-4-methylbenzene;formaldehyde;methane is C.C#Cc1ccc(C)cc1.C=O.
What is the InChIKey of 1-ethynyl-4-methylbenzene;formaldehyde;methane?
The InChIKey is QYKGDJSRQNRAEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.CH2O.CH4/c1-3-9-6-4-8(2)5-7-9;1-2;/h1,4-7H,2H3;1H2;1H4.
What are the key properties of 1-ethynyl-4-methylbenzene;formaldehyde;methane?
1-ethynyl-4-methylbenzene;formaldehyde;methane has a molecular weight of 162.23 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-4-methylbenzene;formaldehyde;methane is sourced from PubChem (CID 143289915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).