C23H22 — CID 159671138
1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene (PubChem CID 159671138) has the molecular formula C23H22 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene.
| Compound Name | 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene |
|---|---|
| PubChem CID | 159671138 |
| Molecular Formula | C23H22 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene |
| SMILES | C#Cc1ccc(CC(=C)/C=C/C(=C)Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H22/c1-5-21-12-14-23(15-13-21)17-20(4)7-6-19(3)16-22-10-8-18(2)9-11-22/h1,6-15H,3-4,16-17H2,2H3/b7-6+ |
| InChIKey | MGRFWLPBEIEHLT-VOTSOKGWSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|