About 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene
1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene (PubChem CID 159671138) has the molecular formula C23H22
and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene.
Molecular Properties
| Compound Name | 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene |
| PubChem CID | 159671138 |
| Molecular Formula | C23H22 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene |
| SMILES | C#Cc1ccc(CC(=C)/C=C/C(=C)Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H22/c1-5-21-12-14-23(15-13-21)17-20(4)7-6-19(3)16-22-10-8-18(2)9-11-22/h1,6-15H,3-4,16-17H2,2H3/b7-6+ |
| InChIKey | MGRFWLPBEIEHLT-VOTSOKGWSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene?
The IUPAC name of 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene (CID 159671138) is 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene.
What is the SMILES notation for 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene?
The canonical SMILES for 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene is C#Cc1ccc(CC(=C)/C=C/C(=C)Cc2ccc(C)cc2)cc1.
What is the InChIKey of 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene?
The InChIKey is MGRFWLPBEIEHLT-VOTSOKGWSA-N. The full InChI is InChI=1S/C23H22/c1-5-21-12-14-23(15-13-21)17-20(4)7-6-19(3)16-22-10-8-18(2)9-11-22/h1,6-15H,3-4,16-17H2,2H3/b7-6+.
What are the key properties of 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene?
1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene has a molecular weight of 298.43 g/mol, XLogP of 5.43, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-4-[(3E)-2-methylidene-5-[(4-methylphenyl)methyl]hexa-3,5-dienyl]benzene is sourced from PubChem (CID 159671138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).