C25H25N — CID 59728644
4-methyl-N-[4-(2-methylidenebut-3-enyl)phenyl]-N-(4-methylphenyl)aniline (PubChem CID 59728644) has the molecular formula C25H25N and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-methyl-N-[4-(2-methylidenebut-3-enyl)phenyl]-N-(4-methylphenyl)aniline.
| Compound Name | 4-methyl-N-[4-(2-methylidenebut-3-enyl)phenyl]-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 59728644 |
| Molecular Formula | C25H25N |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 4-methyl-N-[4-(2-methylidenebut-3-enyl)phenyl]-N-(4-methylphenyl)aniline |
| SMILES | C=CC(=C)Cc1ccc(N(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H25N/c1-5-19(2)18-22-10-16-25(17-11-22)26(23-12-6-20(3)7-13-23)24-14-8-21(4)9-15-24/h5-17H,1-2,18H2,3-4H3 |
| InChIKey | SVGNPBGOUNADAI-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|