C19H30 — CID 143774858
1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene (PubChem CID 143774858) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene.
| Compound Name | 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene |
|---|---|
| PubChem CID | 143774858 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene |
| SMILES | C.C=C(C)CC.C=CC(=C)Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C13H16.C5H10.CH4/c1-4-11(3)10-13-8-6-12(5-2)7-9-13;1-4-5(2)3;/h4,6-9H,1,3,5,10H2,2H3;2,4H2,1,3H3;1H4 |
| InChIKey | ANXGLSVFDVHNRE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|