About 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene
1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene (PubChem CID 143774858) has the molecular formula C19H30
and a molecular weight of 258.45 g/mol. Its IUPAC name is 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene.
Molecular Properties
| Compound Name | 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene |
| PubChem CID | 143774858 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene |
| SMILES | C.C=C(C)CC.C=CC(=C)Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C13H16.C5H10.CH4/c1-4-11(3)10-13-8-6-12(5-2)7-9-13;1-4-5(2)3;/h4,6-9H,1,3,5,10H2,2H3;2,4H2,1,3H3;1H4 |
| InChIKey | ANXGLSVFDVHNRE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene?
The IUPAC name of 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene (CID 143774858) is 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene.
What is the SMILES notation for 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene?
The canonical SMILES for 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene is C.C=C(C)CC.C=CC(=C)Cc1ccc(CC)cc1.
What is the InChIKey of 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene?
The InChIKey is ANXGLSVFDVHNRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16.C5H10.CH4/c1-4-11(3)10-13-8-6-12(5-2)7-9-13;1-4-5(2)3;/h4,6-9H,1,3,5,10H2,2H3;2,4H2,1,3H3;1H4.
What are the key properties of 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene?
1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene has a molecular weight of 258.45 g/mol, XLogP of 6.14, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(2-methylidenebut-3-enyl)benzene;methane;2-methylbut-1-ene is sourced from PubChem (CID 143774858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).