C26H27N — CID 88855641
N-[4-[(3E)-hexa-3,5-dienyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline (PubChem CID 88855641) has the molecular formula C26H27N and a molecular weight of 353.51 g/mol. Its IUPAC name is N-[4-[(3E)-hexa-3,5-dienyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-[4-[(3E)-hexa-3,5-dienyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 88855641 |
| Molecular Formula | C26H27N |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-[4-[(3E)-hexa-3,5-dienyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
| SMILES | C=C/C=C/CCc1ccc(N(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H27N/c1-4-5-6-7-8-23-13-19-26(20-14-23)27(24-15-9-21(2)10-16-24)25-17-11-22(3)12-18-25/h4-6,9-20H,1,7-8H2,2-3H3/b6-5+ |
| InChIKey | GXANKFIDJYBRQS-AATRIKPKSA-N |
| XLogP | 7.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|