C64H76N2 — CID 58282093
4-N-[4-(2,5-dihexyl-4-methylphenyl)phenyl]-1-N,4-N-bis[3-[(4E)-hepta-4,6-dienyl]phenyl]-1-N-(4-methylphenyl)benzene-1,4-diamine (PubChem CID 58282093) has the molecular formula C64H76N2 and a molecular weight of 873.33 g/mol. Its IUPAC name is 4-N-[4-(2,5-dihexyl-4-methylphenyl)phenyl]-1-N,4-N-bis[3-[(4E)-hepta-4,6-dienyl]phenyl]-1-N-(4-methylphenyl)benzene-1,4-diamine.
| Compound Name | 4-N-[4-(2,5-dihexyl-4-methylphenyl)phenyl]-1-N,4-N-bis[3-[(4E)-hepta-4,6-dienyl]phenyl]-1-N-(4-methylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 58282093 |
| Molecular Formula | C64H76N2 |
| Molecular Weight | 873.33 g/mol |
| Exact Mass | 872.60 |
| IUPAC Name | 4-N-[4-(2,5-dihexyl-4-methylphenyl)phenyl]-1-N,4-N-bis[3-[(4E)-hepta-4,6-dienyl]phenyl]-1-N-(4-methylphenyl)benzene-1,4-diamine |
| SMILES | C=C/C=C/CCCc1cccc(N(c2ccc(C)cc2)c2ccc(N(c3ccc(-c4cc(CCCCCC)c(C)cc4CCCCCC)cc3)c3cccc(CCC/C=C/C=C)c3)cc2)c1 |
| InChI | InChI=1S/C64H76N2/c1-7-11-15-19-21-27-53-29-25-33-62(48-53)65(58-39-35-51(5)36-40-58)60-43-45-61(46-44-60)66(63-34-26-30-54(49-63)28-22-20-16-12-8-2)59-41-37-55(38-42-59)64-50-56(31-23-17-13-9-3)52(6)47-57(64)32-24-18-14-10-4/h7-8,11-12,15-16,25-26,29-30,33-50H,1-2,9-10,13-14,17-24,27-28,31-32H2,3-6H3/b15-11+,16-12+ |
| InChIKey | CNKBYCCZHFQLRC-JOBJLJCHSA-N |
| XLogP | 19.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.33 |
| LogP ≤ 5 | 19.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|