C13H14O — CID 88908789
4-[(3Z)-hexa-3,5-dienyl]benzaldehyde (PubChem CID 88908789) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde.
| Compound Name | 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde |
|---|---|
| PubChem CID | 88908789 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde |
| SMILES | C=C/C=C\CCc1ccc(C=O)cc1 |
| InChI | InChI=1S/C13H14O/c1-2-3-4-5-6-12-7-9-13(11-14)10-8-12/h2-4,7-11H,1,5-6H2/b4-3- |
| InChIKey | IHDWGHJJWOSTBZ-ARJAWSKDSA-N |
| XLogP | 3.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|