About 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde
4-[(3Z)-hexa-3,5-dienyl]benzaldehyde (PubChem CID 88908789) has the molecular formula C13H14O
and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde |
| PubChem CID | 88908789 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde |
| SMILES | C=C/C=C\CCc1ccc(C=O)cc1 |
| InChI | InChI=1S/C13H14O/c1-2-3-4-5-6-12-7-9-13(11-14)10-8-12/h2-4,7-11H,1,5-6H2/b4-3- |
| InChIKey | IHDWGHJJWOSTBZ-ARJAWSKDSA-N |
| XLogP | 3.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde?
The IUPAC name of 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde (CID 88908789) is 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde.
What is the SMILES notation for 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde?
The canonical SMILES for 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde is C=C/C=C\CCc1ccc(C=O)cc1.
What is the InChIKey of 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde?
The InChIKey is IHDWGHJJWOSTBZ-ARJAWSKDSA-N. The full InChI is InChI=1S/C13H14O/c1-2-3-4-5-6-12-7-9-13(11-14)10-8-12/h2-4,7-11H,1,5-6H2/b4-3-.
What are the key properties of 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde?
4-[(3Z)-hexa-3,5-dienyl]benzaldehyde has a molecular weight of 186.25 g/mol, XLogP of 3.17, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3Z)-hexa-3,5-dienyl]benzaldehyde is sourced from PubChem (CID 88908789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).