C10H12OS2 — CID 57042412
4-[3,3-bis(sulfanyl)propyl]benzaldehyde (PubChem CID 57042412) has the molecular formula C10H12OS2 and a molecular weight of 212.34 g/mol. Its IUPAC name is 4-[3,3-bis(sulfanyl)propyl]benzaldehyde.
| Compound Name | 4-[3,3-bis(sulfanyl)propyl]benzaldehyde |
|---|---|
| PubChem CID | 57042412 |
| Molecular Formula | C10H12OS2 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 4-[3,3-bis(sulfanyl)propyl]benzaldehyde |
| SMILES | O=Cc1ccc(CCC(S)S)cc1 |
| InChI | InChI=1S/C10H12OS2/c11-7-9-3-1-8(2-4-9)5-6-10(12)13/h1-4,7,10,12-13H,5-6H2 |
| InChIKey | ZQLHMPGRIDANRY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|