About N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal
N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal (PubChem CID 142281771) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal.
Molecular Properties
| Compound Name | N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal |
| PubChem CID | 142281771 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal |
| SMILES | C/C=C/CCc1ccc(NC)cc1.C=CC=O |
| InChI | InChI=1S/C12H17N.C3H4O/c1-3-4-5-6-11-7-9-12(13-2)10-8-11;1-2-3-4/h3-4,7-10,13H,5-6H2,1-2H3;2-3H,1H2/b4-3+; |
| InChIKey | QOVCKGKLXVWBNU-BJILWQEISA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal?
The IUPAC name of N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal (CID 142281771) is N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal.
What is the SMILES notation for N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal?
The canonical SMILES for N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal is C/C=C/CCc1ccc(NC)cc1.C=CC=O.
What is the InChIKey of N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal?
The InChIKey is QOVCKGKLXVWBNU-BJILWQEISA-N. The full InChI is InChI=1S/C12H17N.C3H4O/c1-3-4-5-6-11-7-9-12(13-2)10-8-11;1-2-3-4/h3-4,7-10,13H,5-6H2,1-2H3;2-3H,1H2/b4-3+;.
What are the key properties of N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal?
N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal has a molecular weight of 231.34 g/mol, XLogP of 3.61, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-[(E)-pent-3-enyl]aniline;prop-2-enal is sourced from PubChem (CID 142281771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).