About methanol;4-(methylamino)benzaldehyde;prop-2-enal
methanol;4-(methylamino)benzaldehyde;prop-2-enal (PubChem CID 153387610) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is methanol;4-(methylamino)benzaldehyde;prop-2-enal.
Molecular Properties
| Compound Name | methanol;4-(methylamino)benzaldehyde;prop-2-enal |
| PubChem CID | 153387610 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methanol;4-(methylamino)benzaldehyde;prop-2-enal |
| SMILES | C=CC=O.CNc1ccc(C=O)cc1.CO |
| InChI | InChI=1S/C8H9NO.C3H4O.CH4O/c1-9-8-4-2-7(6-10)3-5-8;1-2-3-4;1-2/h2-6,9H,1H3;2-3H,1H2;2H,1H3 |
| InChIKey | LJQFSDUJTJUDGE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methanol;4-(methylamino)benzaldehyde;prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;4-(methylamino)benzaldehyde;prop-2-enal?
The IUPAC name of methanol;4-(methylamino)benzaldehyde;prop-2-enal (CID 153387610) is methanol;4-(methylamino)benzaldehyde;prop-2-enal.
What is the SMILES notation for methanol;4-(methylamino)benzaldehyde;prop-2-enal?
The canonical SMILES for methanol;4-(methylamino)benzaldehyde;prop-2-enal is C=CC=O.CNc1ccc(C=O)cc1.CO.
What is the InChIKey of methanol;4-(methylamino)benzaldehyde;prop-2-enal?
The InChIKey is LJQFSDUJTJUDGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C3H4O.CH4O/c1-9-8-4-2-7(6-10)3-5-8;1-2-3-4;1-2/h2-6,9H,1H3;2-3H,1H2;2H,1H3.
What are the key properties of methanol;4-(methylamino)benzaldehyde;prop-2-enal?
methanol;4-(methylamino)benzaldehyde;prop-2-enal has a molecular weight of 223.27 g/mol, XLogP of 1.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;4-(methylamino)benzaldehyde;prop-2-enal is sourced from PubChem (CID 153387610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).