About 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane
4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane (PubChem CID 142476509) has the molecular formula C18H26N4O
and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane.
Molecular Properties
| Compound Name | 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane |
| PubChem CID | 142476509 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane |
| SMILES | CC.CNc1ccc(/C(N)=C/NN)cc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C9H14N4.C7H6O.C2H6/c1-12-8-4-2-7(3-5-8)9(10)6-13-11;8-6-7-4-2-1-3-5-7;1-2/h2-6,12-13H,10-11H2,1H3;1-6H;1-2H3/b9-6-;; |
| InChIKey | DTEIWDYQPLLOMH-MPTFJDTDSA-N |
| XLogP | 2.97 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane?
The IUPAC name of 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane (CID 142476509) is 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane.
What is the SMILES notation for 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane?
The canonical SMILES for 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane is CC.CNc1ccc(/C(N)=C/NN)cc1.O=Cc1ccccc1.
What is the InChIKey of 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane?
The InChIKey is DTEIWDYQPLLOMH-MPTFJDTDSA-N. The full InChI is InChI=1S/C9H14N4.C7H6O.C2H6/c1-12-8-4-2-7(3-5-8)9(10)6-13-11;8-6-7-4-2-1-3-5-7;1-2/h2-6,12-13H,10-11H2,1H3;1-6H;1-2H3/b9-6-;;.
What are the key properties of 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane?
4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane has a molecular weight of 314.43 g/mol, XLogP of 2.97, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-1-amino-2-hydrazinylethenyl]-N-methylaniline;benzaldehyde;ethane is sourced from PubChem (CID 142476509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).