About benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine
benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine (PubChem CID 87691755) has the molecular formula C18H22N2O3
and a molecular weight of 314.39 g/mol. Its IUPAC name is benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine.
Molecular Properties
| Compound Name | benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine |
| PubChem CID | 87691755 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine |
| SMILES | CC(=O)Nc1ccc(C=O)cc1.CNC.O=Cc1ccccc1 |
| InChI | InChI=1S/C9H9NO2.C7H6O.C2H7N/c1-7(12)10-9-4-2-8(6-11)3-5-9;8-6-7-4-2-1-3-5-7;1-3-2/h2-6H,1H3,(H,10,12);1-6H;3H,1-2H3 |
| InChIKey | UKFVQDXAGYQPJN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine?
The IUPAC name of benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine (CID 87691755) is benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine.
What is the SMILES notation for benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine?
The canonical SMILES for benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine is CC(=O)Nc1ccc(C=O)cc1.CNC.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine?
The InChIKey is UKFVQDXAGYQPJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2.C7H6O.C2H7N/c1-7(12)10-9-4-2-8(6-11)3-5-9;8-6-7-4-2-1-3-5-7;1-3-2/h2-6H,1H3,(H,10,12);1-6H;3H,1-2H3.
What are the key properties of benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine?
benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine has a molecular weight of 314.39 g/mol, XLogP of 2.79, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;N-(4-formylphenyl)acetamide;N-methylmethanamine is sourced from PubChem (CID 87691755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).