About but-1-ene;4-butyl-N-methylaniline
but-1-ene;4-butyl-N-methylaniline (PubChem CID 142016759) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is but-1-ene;4-butyl-N-methylaniline.
Molecular Properties
| Compound Name | but-1-ene;4-butyl-N-methylaniline |
| PubChem CID | 142016759 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | but-1-ene;4-butyl-N-methylaniline |
| SMILES | C=CCC.CCCCc1ccc(NC)cc1 |
| InChI | InChI=1S/C11H17N.C4H8/c1-3-4-5-10-6-8-11(12-2)9-7-10;1-3-4-2/h6-9,12H,3-5H2,1-2H3;3H,1,4H2,2H3 |
| InChIKey | RNWDXJCPSOTPAI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;4-butyl-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;4-butyl-N-methylaniline?
The IUPAC name of but-1-ene;4-butyl-N-methylaniline (CID 142016759) is but-1-ene;4-butyl-N-methylaniline.
What is the SMILES notation for but-1-ene;4-butyl-N-methylaniline?
The canonical SMILES for but-1-ene;4-butyl-N-methylaniline is C=CCC.CCCCc1ccc(NC)cc1.
What is the InChIKey of but-1-ene;4-butyl-N-methylaniline?
The InChIKey is RNWDXJCPSOTPAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.C4H8/c1-3-4-5-10-6-8-11(12-2)9-7-10;1-3-4-2/h6-9,12H,3-5H2,1-2H3;3H,1,4H2,2H3.
What are the key properties of but-1-ene;4-butyl-N-methylaniline?
but-1-ene;4-butyl-N-methylaniline has a molecular weight of 219.37 g/mol, XLogP of 4.65, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;4-butyl-N-methylaniline is sourced from PubChem (CID 142016759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).