C30H30 — CID 19780599
1,4-bis[(E)-2-(4-but-3-enylphenyl)ethenyl]benzene (PubChem CID 19780599) has the molecular formula C30H30 and a molecular weight of 390.57 g/mol. Its IUPAC name is 1,4-bis[(E)-2-(4-but-3-enylphenyl)ethenyl]benzene.
| Compound Name | 1,4-bis[(E)-2-(4-but-3-enylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 19780599 |
| Molecular Formula | C30H30 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 1,4-bis[(E)-2-(4-but-3-enylphenyl)ethenyl]benzene |
| SMILES | C=CCCc1ccc(/C=C/c2ccc(/C=C/c3ccc(CCC=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H30/c1-3-5-7-25-9-13-27(14-10-25)17-19-29-21-23-30(24-22-29)20-18-28-15-11-26(12-16-28)8-6-4-2/h3-4,9-24H,1-2,5-8H2/b19-17+,20-18+ |
| InChIKey | SVYDTENOXNOCMH-XPWSMXQVSA-N |
| XLogP | 8.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|