C12H16 — CID 24721981
4-but-3-enyl-1,2-dimethylbenzene (PubChem CID 24721981) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 4-but-3-enyl-1,2-dimethylbenzene.
| Compound Name | 4-but-3-enyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 24721981 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 4-but-3-enyl-1,2-dimethylbenzene |
| SMILES | C=CCCc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H16/c1-4-5-6-12-8-7-10(2)11(3)9-12/h4,7-9H,1,5-6H2,2-3H3 |
| InChIKey | DRMFMZUPXVPDOO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|