C15H24N2 — CID 105215088
1-(3,4-dimethylphenyl)hept-6-en-2-ylhydrazine (PubChem CID 105215088) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)hept-6-en-2-ylhydrazine.
| Compound Name | 1-(3,4-dimethylphenyl)hept-6-en-2-ylhydrazine |
|---|---|
| PubChem CID | 105215088 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-(3,4-dimethylphenyl)hept-6-en-2-ylhydrazine |
| SMILES | C=CCCCC(Cc1ccc(C)c(C)c1)NN |
| InChI | InChI=1S/C15H24N2/c1-4-5-6-7-15(17-16)11-14-9-8-12(2)13(3)10-14/h4,8-10,15,17H,1,5-7,11,16H2,2-3H3 |
| InChIKey | BYMRDTQXZOFERU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|