C17H24O — CID 143570593
1-(buta-1,3-dien-2-yloxymethyl)-4-ethynylbenzene;ethane (PubChem CID 143570593) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(buta-1,3-dien-2-yloxymethyl)-4-ethynylbenzene;ethane.
| Compound Name | 1-(buta-1,3-dien-2-yloxymethyl)-4-ethynylbenzene;ethane |
|---|---|
| PubChem CID | 143570593 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-(buta-1,3-dien-2-yloxymethyl)-4-ethynylbenzene;ethane |
| SMILES | C#Cc1ccc(COC(=C)C=C)cc1.CC.CC |
| InChI | InChI=1S/C13H12O.2C2H6/c1-4-11(3)14-10-13-8-6-12(5-2)7-9-13;2*1-2/h2,4,6-9H,1,3,10H2;2*1-2H3 |
| InChIKey | BIOVTQANBHEGFQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|