C15H16O2 — CID 118097697
6-(buta-1,3-dien-2-yloxymethyl)-1,4-dihydronaphthalen-2-ol (PubChem CID 118097697) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 6-(buta-1,3-dien-2-yloxymethyl)-1,4-dihydronaphthalen-2-ol.
| Compound Name | 6-(buta-1,3-dien-2-yloxymethyl)-1,4-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 118097697 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 6-(buta-1,3-dien-2-yloxymethyl)-1,4-dihydronaphthalen-2-ol |
| SMILES | C=CC(=C)OCc1ccc2c(c1)CC=C(O)C2 |
| InChI | InChI=1S/C15H16O2/c1-3-11(2)17-10-12-4-5-14-9-15(16)7-6-13(14)8-12/h3-5,7-8,16H,1-2,6,9-10H2 |
| InChIKey | PYQZVAZPQWCPCT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|