C12H14O3S — CID 123543652
1-(buta-1,3-dien-2-yloxymethyl)-3-methylsulfonylbenzene (PubChem CID 123543652) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is 1-(buta-1,3-dien-2-yloxymethyl)-3-methylsulfonylbenzene.
| Compound Name | 1-(buta-1,3-dien-2-yloxymethyl)-3-methylsulfonylbenzene |
|---|---|
| PubChem CID | 123543652 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-(buta-1,3-dien-2-yloxymethyl)-3-methylsulfonylbenzene |
| SMILES | C=CC(=C)OCc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H14O3S/c1-4-10(2)15-9-11-6-5-7-12(8-11)16(3,13)14/h4-8H,1-2,9H2,3H3 |
| InChIKey | RWWBWZVSEWNSLW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|