About (4-ethynylphenyl)methyl carbamate
(4-ethynylphenyl)methyl carbamate (PubChem CID 126697141) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is (4-ethynylphenyl)methyl carbamate.
Molecular Properties
| Compound Name | (4-ethynylphenyl)methyl carbamate |
| PubChem CID | 126697141 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (4-ethynylphenyl)methyl carbamate |
| SMILES | C#Cc1ccc(COC(N)=O)cc1 |
| InChI | InChI=1S/C10H9NO2/c1-2-8-3-5-9(6-4-8)7-13-10(11)12/h1,3-6H,7H2,(H2,11,12) |
| InChIKey | VSFDAEUABNDCAS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-ethynylphenyl)methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethynylphenyl)methyl carbamate?
The IUPAC name of (4-ethynylphenyl)methyl carbamate (CID 126697141) is (4-ethynylphenyl)methyl carbamate.
What is the SMILES notation for (4-ethynylphenyl)methyl carbamate?
The canonical SMILES for (4-ethynylphenyl)methyl carbamate is C#Cc1ccc(COC(N)=O)cc1.
What is the InChIKey of (4-ethynylphenyl)methyl carbamate?
The InChIKey is VSFDAEUABNDCAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-2-8-3-5-9(6-4-8)7-13-10(11)12/h1,3-6H,7H2,(H2,11,12).
What are the key properties of (4-ethynylphenyl)methyl carbamate?
(4-ethynylphenyl)methyl carbamate has a molecular weight of 175.19 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethynylphenyl)methyl carbamate is sourced from PubChem (CID 126697141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).