About (4-ethynylphenyl) prop-2-enoate
(4-ethynylphenyl) prop-2-enoate (PubChem CID 71343404) has the molecular formula C11H8O2
and a molecular weight of 172.18 g/mol. Its IUPAC name is (4-ethynylphenyl) prop-2-enoate.
Molecular Properties
| Compound Name | (4-ethynylphenyl) prop-2-enoate |
| PubChem CID | 71343404 |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | (4-ethynylphenyl) prop-2-enoate |
| SMILES | C#Cc1ccc(OC(=O)C=C)cc1 |
| InChI | InChI=1S/C11H8O2/c1-3-9-5-7-10(8-6-9)13-11(12)4-2/h1,4-8H,2H2 |
| InChIKey | AZIDPYJKSWNQRP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-ethynylphenyl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethynylphenyl) prop-2-enoate?
The IUPAC name of (4-ethynylphenyl) prop-2-enoate (CID 71343404) is (4-ethynylphenyl) prop-2-enoate.
What is the SMILES notation for (4-ethynylphenyl) prop-2-enoate?
The canonical SMILES for (4-ethynylphenyl) prop-2-enoate is C#Cc1ccc(OC(=O)C=C)cc1.
What is the InChIKey of (4-ethynylphenyl) prop-2-enoate?
The InChIKey is AZIDPYJKSWNQRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2/c1-3-9-5-7-10(8-6-9)13-11(12)4-2/h1,4-8H,2H2.
What are the key properties of (4-ethynylphenyl) prop-2-enoate?
(4-ethynylphenyl) prop-2-enoate has a molecular weight of 172.18 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethynylphenyl) prop-2-enoate is sourced from PubChem (CID 71343404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).