About (4-hydroxyphenyl) prop-2-enoate;methoxymethane
(4-hydroxyphenyl) prop-2-enoate;methoxymethane (PubChem CID 67882332) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is (4-hydroxyphenyl) prop-2-enoate;methoxymethane.
Molecular Properties
| Compound Name | (4-hydroxyphenyl) prop-2-enoate;methoxymethane |
| PubChem CID | 67882332 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (4-hydroxyphenyl) prop-2-enoate;methoxymethane |
| SMILES | C=CC(=O)Oc1ccc(O)cc1.COC |
| InChI | InChI=1S/C9H8O3.C2H6O/c1-2-9(11)12-8-5-3-7(10)4-6-8;1-3-2/h2-6,10H,1H2;1-2H3 |
| InChIKey | MDSMCDPZYNHNAU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxyphenyl) prop-2-enoate;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl) prop-2-enoate;methoxymethane?
The IUPAC name of (4-hydroxyphenyl) prop-2-enoate;methoxymethane (CID 67882332) is (4-hydroxyphenyl) prop-2-enoate;methoxymethane.
What is the SMILES notation for (4-hydroxyphenyl) prop-2-enoate;methoxymethane?
The canonical SMILES for (4-hydroxyphenyl) prop-2-enoate;methoxymethane is C=CC(=O)Oc1ccc(O)cc1.COC.
What is the InChIKey of (4-hydroxyphenyl) prop-2-enoate;methoxymethane?
The InChIKey is MDSMCDPZYNHNAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3.C2H6O/c1-2-9(11)12-8-5-3-7(10)4-6-8;1-3-2/h2-6,10H,1H2;1-2H3.
What are the key properties of (4-hydroxyphenyl) prop-2-enoate;methoxymethane?
(4-hydroxyphenyl) prop-2-enoate;methoxymethane has a molecular weight of 210.23 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl) prop-2-enoate;methoxymethane is sourced from PubChem (CID 67882332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).