C28H20O3 — CID 89273761
[4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] prop-2-enoate (PubChem CID 89273761) has the molecular formula C28H20O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is [4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] prop-2-enoate.
| Compound Name | [4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 89273761 |
| Molecular Formula | C28H20O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C2(c3ccc(O)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C28H20O3/c1-2-27(30)31-22-17-13-20(14-18-22)28(19-11-15-21(29)16-12-19)25-9-5-3-7-23(25)24-8-4-6-10-26(24)28/h2-18,29H,1H2 |
| InChIKey | QIMZOBIDFKJSOX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|